![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| covers/ | 2023-02-16 16:25 | - | |
| 15. M-Four.mp3 | 2023-02-16 16:58 | 7.9M | |
| 14. Mobility.mp3 | 2023-02-16 16:54 | 14M | |
| 13. Barracuda.mp3 | 2023-02-16 16:59 | 13M | |
| 12. Peace Head.mp3 | 2023-02-16 17:00 | 12M | |
| 11. Time Signature.mp3 | 2023-02-16 16:59 | 9.6M | |
| 10. Drug Fits The Face.mp3 | 2023-02-16 16:51 | 8.8M | |
| 09. Voodoo Child (Remix).mp3 | 2023-02-16 16:44 | 9.0M | |
| 08. Permanent Green.mp3 | 2023-02-16 16:56 | 13M | |
| 07. Go (Original).mp3 | 2023-02-16 16:48 | 14M | |
| 06. Protect Write.mp3 | 2023-02-16 16:58 | 13M | |
| 05. Party Time.mp3 | 2023-02-16 16:55 | 9.7M | |
| 04. UHF3.mp3 | 2023-02-16 16:48 | 12M | |
| 03. Move The Colors.mp3 | 2023-02-16 16:47 | 9.4M | |
| 02. Rock The House.mp3 | 2023-02-16 16:48 | 10M | |
| 01. Besame.mp3 | 2023-02-16 16:46 | 8.5M | |